C30H27F5O2 — CID 139853890
(5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate (PubChem CID 139853890) has the molecular formula C30H27F5O2 and a molecular weight of 514.53 g/mol. Its IUPAC name is (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate.
| Compound Name | (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 139853890 |
| Molecular Formula | C30H27F5O2 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate |
| SMILES | CCCCCC1CCC(C#Cc2cc(F)c(C(=O)Oc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H27F5O2/c1-2-3-4-5-18-6-8-19(9-7-18)10-11-20-14-24(31)27(25(32)15-20)30(36)37-22-12-13-23-21(16-22)17-26(33)29(35)28(23)34/h12-19H,2-9H2,1H3 |
| InChIKey | JSOQPMSOAUPBDW-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|