C30H28F2O2 — CID 139853913
(5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]benzoate (PubChem CID 139853913) has the molecular formula C30H28F2O2 and a molecular weight of 458.55 g/mol. Its IUPAC name is (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]benzoate.
| Compound Name | (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 139853913 |
| Molecular Formula | C30H28F2O2 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]benzoate |
| SMILES | C/C=C/CCC1CCC(C#Cc2ccc(C(=O)Oc3ccc4c(F)cccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H28F2O2/c1-2-3-4-6-21-9-11-22(12-10-21)13-14-23-15-17-27(29(32)19-23)30(33)34-25-16-18-26-24(20-25)7-5-8-28(26)31/h2-3,5,7-8,15-22H,4,6,9-12H2,1H3/b3-2+ |
| InChIKey | OBNUMUNZSJDBAT-NSCUHMNNSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|