C28H21F5O2 — CID 139854392
(5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate (PubChem CID 139854392) has the molecular formula C28H21F5O2 and a molecular weight of 484.46 g/mol. Its IUPAC name is (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate.
| Compound Name | (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 139854392 |
| Molecular Formula | C28H21F5O2 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (5,6,7-trifluoronaphthalen-2-yl) 2,6-difluoro-4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate |
| SMILES | C/C=C/C1CCC(C#Cc2cc(F)c(C(=O)Oc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H21F5O2/c1-2-3-16-4-6-17(7-5-16)8-9-18-12-22(29)25(23(30)13-18)28(34)35-20-10-11-21-19(14-20)15-24(31)27(33)26(21)32/h2-3,10-17H,4-7H2,1H3/b3-2+ |
| InChIKey | MTUYUNFKMCHATJ-NSCUHMNNSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|