C28H25FO2 — CID 139853991
(5-fluoronaphthalen-2-yl) 4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate (PubChem CID 139853991) has the molecular formula C28H25FO2 and a molecular weight of 412.50 g/mol. Its IUPAC name is (5-fluoronaphthalen-2-yl) 4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate.
| Compound Name | (5-fluoronaphthalen-2-yl) 4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 139853991 |
| Molecular Formula | C28H25FO2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (5-fluoronaphthalen-2-yl) 4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethynyl]benzoate |
| SMILES | C/C=C/C1CCC(C#Cc2ccc(C(=O)Oc3ccc4c(F)cccc4c3)cc2)CC1 |
| InChI | InChI=1S/C28H25FO2/c1-2-4-20-7-9-21(10-8-20)11-12-22-13-15-23(16-14-22)28(30)31-25-17-18-26-24(19-25)5-3-6-27(26)29/h2-6,13-21H,7-10H2,1H3/b4-2+ |
| InChIKey | FUCVRHLFXQZCGN-DUXPYHPUSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|