C30H29F3O2 — CID 139854238
(5-fluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate (PubChem CID 139854238) has the molecular formula C30H29F3O2 and a molecular weight of 478.55 g/mol. Its IUPAC name is (5-fluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate.
| Compound Name | (5-fluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 139854238 |
| Molecular Formula | C30H29F3O2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (5-fluoronaphthalen-2-yl) 2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethynyl]benzoate |
| SMILES | CCCCCC1CCC(C#Cc2cc(F)c(C(=O)Oc3ccc4c(F)cccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H29F3O2/c1-2-3-4-6-20-9-11-21(12-10-20)13-14-22-17-27(32)29(28(33)18-22)30(34)35-24-15-16-25-23(19-24)7-5-8-26(25)31/h5,7-8,15-21H,2-4,6,9-12H2,1H3 |
| InChIKey | DUNCAAFESSASMA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|