C26H24F4O2 — CID 139853961
(6,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 139853961) has the molecular formula C26H24F4O2 and a molecular weight of 444.47 g/mol. Its IUPAC name is (6,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | (6,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 139853961 |
| Molecular Formula | C26H24F4O2 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (6,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2cc(F)c(C(=O)Oc3ccc4cc(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H24F4O2/c1-2-3-15-4-6-16(7-5-15)19-13-23(29)25(24(30)14-19)26(31)32-20-9-8-17-11-21(27)22(28)12-18(17)10-20/h8-16H,2-7H2,1H3 |
| InChIKey | RCAJPSULKRBVMP-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|