C24H30F2O2 — CID 139853971
(6,7-difluoronaphthalen-2-yl) 4-heptylcyclohexane-1-carboxylate (PubChem CID 139853971) has the molecular formula C24H30F2O2 and a molecular weight of 388.50 g/mol. Its IUPAC name is (6,7-difluoronaphthalen-2-yl) 4-heptylcyclohexane-1-carboxylate.
| Compound Name | (6,7-difluoronaphthalen-2-yl) 4-heptylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139853971 |
| Molecular Formula | C24H30F2O2 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (6,7-difluoronaphthalen-2-yl) 4-heptylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCC1CCC(C(=O)Oc2ccc3cc(F)c(F)cc3c2)CC1 |
| InChI | InChI=1S/C24H30F2O2/c1-2-3-4-5-6-7-17-8-10-18(11-9-17)24(27)28-21-13-12-19-15-22(25)23(26)16-20(19)14-21/h12-18H,2-11H2,1H3 |
| InChIKey | QJLJLELOAGBOCS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|