C26H37F3O2S — CID 56633222
[4-(difluoromethylsulfanyl)-3-fluorophenyl] 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 56633222) has the molecular formula C26H37F3O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is [4-(difluoromethylsulfanyl)-3-fluorophenyl] 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(difluoromethylsulfanyl)-3-fluorophenyl] 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 56633222 |
| Molecular Formula | C26H37F3O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [4-(difluoromethylsulfanyl)-3-fluorophenyl] 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC(C2CCC(C(=O)Oc3ccc(SC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H37F3O2S/c1-2-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)25(30)31-22-15-16-24(23(27)17-22)32-26(28)29/h15-21,26H,2-14H2,1H3 |
| InChIKey | BBEOBWMCNDSYOU-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|