C25H29F7O4 — CID 20615039
[4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl] 2,6-difluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 20615039) has the molecular formula C25H29F7O4 and a molecular weight of 526.49 g/mol. Its IUPAC name is [4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl] 2,6-difluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | [4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl] 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 20615039 |
| Molecular Formula | C25H29F7O4 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | [4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl] 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2cc(F)c(C(=O)OC3CCC(OC(=O)C(F)(F)C(F)(F)F)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H29F7O4/c1-2-3-14-4-6-15(7-5-14)16-12-19(26)21(20(27)13-16)22(33)35-17-8-10-18(11-9-17)36-23(34)24(28,29)25(30,31)32/h12-15,17-18H,2-11H2,1H3 |
| InChIKey | DWMTYIXSIIUPIN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|