C24H33F5O2 — CID 20615145
[4-[4-(4-propylcyclohexen-1-yl)cyclohexyl]cyclohex-3-en-1-yl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 20615145) has the molecular formula C24H33F5O2 and a molecular weight of 448.52 g/mol. Its IUPAC name is [4-[4-(4-propylcyclohexen-1-yl)cyclohexyl]cyclohex-3-en-1-yl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[4-(4-propylcyclohexen-1-yl)cyclohexyl]cyclohex-3-en-1-yl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 20615145 |
| Molecular Formula | C24H33F5O2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [4-[4-(4-propylcyclohexen-1-yl)cyclohexyl]cyclohex-3-en-1-yl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCCC1CC=C(C2CCC(C3=CCC(OC(=O)C(F)(F)C(F)(F)F)CC3)CC2)CC1 |
| InChI | InChI=1S/C24H33F5O2/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(15-13-20)31-22(30)23(25,26)24(27,28)29/h6,12,16,18-19,21H,2-5,7-11,13-15H2,1H3 |
| InChIKey | QGDMCBGOLOGARE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|