C33H55NO — CID 135214899
N-methyl-N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide (PubChem CID 135214899) has the molecular formula C33H55NO and a molecular weight of 481.81 g/mol. Its IUPAC name is N-methyl-N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-methyl-N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 135214899 |
| Molecular Formula | C33H55NO |
| Molecular Weight | 481.81 g/mol |
| Exact Mass | 481.43 |
| IUPAC Name | N-methyl-N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)C1CCC(C2CCC(C3=CCC(C4CCC(CCCCC)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C33H55NO/c1-4-6-7-8-25-9-11-26(12-10-25)27-13-15-28(16-14-27)29-17-19-30(20-18-29)31-21-23-32(24-22-31)34(3)33(35)5-2/h5,15,25-27,29-32H,2,4,6-14,16-24H2,1,3H3 |
| InChIKey | SKCLBAKFNJFVBO-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.81 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|