C23H35F3 — CID 126551924
(4R)-4-(4-but-3-enylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]cyclohexene (PubChem CID 126551924) has the molecular formula C23H35F3 and a molecular weight of 368.53 g/mol. Its IUPAC name is (4R)-4-(4-but-3-enylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]cyclohexene.
| Compound Name | (4R)-4-(4-but-3-enylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]cyclohexene |
|---|---|
| PubChem CID | 126551924 |
| Molecular Formula | C23H35F3 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (4R)-4-(4-but-3-enylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]cyclohexene |
| SMILES | C=CCCC1CCC([C@H]2CC=C(C3CCC(C(F)(F)F)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H35F3/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(24,25)26/h2,11,17-19,21-22H,1,3-10,12-16H2/t17?,18?,19-,21?,22?/m0/s1 |
| InChIKey | IFSWMAWGCGNCGM-XLDCJCGGSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|