C30H36ClF — CID 59257319
1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]-3-chloro-4-ethyl-2-fluorobenzene (PubChem CID 59257319) has the molecular formula C30H36ClF and a molecular weight of 451.07 g/mol. Its IUPAC name is 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]-3-chloro-4-ethyl-2-fluorobenzene.
| Compound Name | 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]-3-chloro-4-ethyl-2-fluorobenzene |
|---|---|
| PubChem CID | 59257319 |
| Molecular Formula | C30H36ClF |
| Molecular Weight | 451.07 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]-3-chloro-4-ethyl-2-fluorobenzene |
| SMILES | C=CCCC1CCC(C2CC=C(c3ccc(-c4ccc(CC)c(Cl)c4F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H36ClF/c1-3-5-6-21-7-9-23(10-8-21)24-11-13-25(14-12-24)26-15-17-27(18-16-26)28-20-19-22(4-2)29(31)30(28)32/h3,13,15-21,23-24H,1,4-12,14H2,2H3 |
| InChIKey | ADZMRZKLLZPFEH-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.07 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|