C30H42ClFO — CID 59256952
1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]cyclohexen-1-yl]-3-chloro-4-ethoxy-2-fluorobenzene (PubChem CID 59256952) has the molecular formula C30H42ClFO and a molecular weight of 473.12 g/mol. Its IUPAC name is 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]cyclohexen-1-yl]-3-chloro-4-ethoxy-2-fluorobenzene.
| Compound Name | 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]cyclohexen-1-yl]-3-chloro-4-ethoxy-2-fluorobenzene |
|---|---|
| PubChem CID | 59256952 |
| Molecular Formula | C30H42ClFO |
| Molecular Weight | 473.12 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 1-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]cyclohexen-1-yl]-3-chloro-4-ethoxy-2-fluorobenzene |
| SMILES | C=CCCC1CCC(C2CCC(C3CC=C(c4ccc(OCC)c(Cl)c4F)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H42ClFO/c1-3-5-6-21-7-9-22(10-8-21)23-11-13-24(14-12-23)25-15-17-26(18-16-25)27-19-20-28(33-4-2)29(31)30(27)32/h3,17,19-25H,1,4-16,18H2,2H3 |
| InChIKey | RRQZODOTYHOWGG-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.12 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|