C24H30ClFO — CID 89077035
2-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2-chloro-3-fluorophenyl]oxirane (PubChem CID 89077035) has the molecular formula C24H30ClFO and a molecular weight of 388.95 g/mol. Its IUPAC name is 2-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2-chloro-3-fluorophenyl]oxirane.
| Compound Name | 2-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2-chloro-3-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 89077035 |
| Molecular Formula | C24H30ClFO |
| Molecular Weight | 388.95 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[4-[4-(4-but-3-enylcyclohexyl)cyclohexen-1-yl]-2-chloro-3-fluorophenyl]oxirane |
| SMILES | C=CCCC1CCC(C2CC=C(c3ccc(C4CO4)c(Cl)c3F)CC2)CC1 |
| InChI | InChI=1S/C24H30ClFO/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-14-21(22-15-27-22)23(25)24(20)26/h2,11,13-14,16-18,22H,1,3-10,12,15H2 |
| InChIKey | IZEIVANKZICEFS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.95 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|