C30H27F3O — CID 88571641
2-[4-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88571641) has the molecular formula C30H27F3O and a molecular weight of 460.54 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88571641 |
| Molecular Formula | C30H27F3O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[4-[4-[4-(4-but-3-enylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | C=CCCC1CC=C(c2ccc(-c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C30H27F3O/c1-2-3-4-19-5-7-21(8-6-19)24-14-13-23(17-27(24)31)20-9-11-22(12-10-20)25-15-16-26(28-18-34-28)30(33)29(25)32/h2,7,9-17,19,28H,1,3-6,8,18H2 |
| InChIKey | DWFPWTOZBKMFFG-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|