C22H20ClFO — CID 89077070
2-[2-chloro-4-[4-(4-ethenylcyclohexen-1-yl)phenyl]-3-fluorophenyl]oxirane (PubChem CID 89077070) has the molecular formula C22H20ClFO and a molecular weight of 354.85 g/mol. Its IUPAC name is 2-[2-chloro-4-[4-(4-ethenylcyclohexen-1-yl)phenyl]-3-fluorophenyl]oxirane.
| Compound Name | 2-[2-chloro-4-[4-(4-ethenylcyclohexen-1-yl)phenyl]-3-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 89077070 |
| Molecular Formula | C22H20ClFO |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[2-chloro-4-[4-(4-ethenylcyclohexen-1-yl)phenyl]-3-fluorophenyl]oxirane |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(C4CO4)c(Cl)c3F)cc2)CC1 |
| InChI | InChI=1S/C22H20ClFO/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(20-13-25-20)21(23)22(18)24/h2,5,7-12,14,20H,1,3-4,6,13H2 |
| InChIKey | GEYUMUJKLJVYMP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|