C28H24ClF3O — CID 59257281
1-[4-(2-chloro-4-ethoxy-3-fluorophenyl)phenyl]-4-(4-ethenylcyclohexen-1-yl)-2,3-difluorobenzene (PubChem CID 59257281) has the molecular formula C28H24ClF3O and a molecular weight of 468.95 g/mol. Its IUPAC name is 1-[4-(2-chloro-4-ethoxy-3-fluorophenyl)phenyl]-4-(4-ethenylcyclohexen-1-yl)-2,3-difluorobenzene.
| Compound Name | 1-[4-(2-chloro-4-ethoxy-3-fluorophenyl)phenyl]-4-(4-ethenylcyclohexen-1-yl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 59257281 |
| Molecular Formula | C28H24ClF3O |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-[4-(2-chloro-4-ethoxy-3-fluorophenyl)phenyl]-4-(4-ethenylcyclohexen-1-yl)-2,3-difluorobenzene |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4Cl)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H24ClF3O/c1-3-17-5-7-19(8-6-17)22-13-14-23(27(31)26(22)30)20-11-9-18(10-12-20)21-15-16-24(33-4-2)28(32)25(21)29/h3,7,9-17H,1,4-6,8H2,2H3 |
| InChIKey | FAWZCKOQXCMUGB-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|