C33H32F4O — CID 67739870
1-(4-cyclohexylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorobenzene (PubChem CID 67739870) has the molecular formula C33H32F4O and a molecular weight of 520.61 g/mol. Its IUPAC name is 1-(4-cyclohexylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-cyclohexylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67739870 |
| Molecular Formula | C33H32F4O |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-(4-cyclohexylcyclohexen-1-yl)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorobenzene |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCCCC5)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C33H32F4O/c1-2-20-38-29-19-18-28(32(36)33(29)37)25-14-12-24(13-15-25)27-17-16-26(30(34)31(27)35)23-10-8-22(9-11-23)21-6-4-3-5-7-21/h2,10,12-19,21-22H,1,3-9,11,20H2 |
| InChIKey | NOZZXMYGQLHZBX-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|