C29H30F2O2 — CID 154607241
1-[4-[4-[(4-ethenylcyclohexyl)methoxy]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 154607241) has the molecular formula C29H30F2O2 and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-[4-[4-[(4-ethenylcyclohexyl)methoxy]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[4-[(4-ethenylcyclohexyl)methoxy]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 154607241 |
| Molecular Formula | C29H30F2O2 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-[4-[4-[(4-ethenylcyclohexyl)methoxy]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C=CC1CCC(COc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H30F2O2/c1-3-20-5-7-21(8-6-20)19-33-25-15-13-23(14-16-25)22-9-11-24(12-10-22)26-17-18-27(32-4-2)29(31)28(26)30/h3,9-18,20-21H,1,4-8,19H2,2H3 |
| InChIKey | XDFQUPOSWPQAMS-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|