C31H40F2O2 — CID 123181388
2,3-difluoro-1-prop-1-enoxy-4-[4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]benzene (PubChem CID 123181388) has the molecular formula C31H40F2O2 and a molecular weight of 482.66 g/mol. Its IUPAC name is 2,3-difluoro-1-prop-1-enoxy-4-[4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]benzene.
| Compound Name | 2,3-difluoro-1-prop-1-enoxy-4-[4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]benzene |
|---|---|
| PubChem CID | 123181388 |
| Molecular Formula | C31H40F2O2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2,3-difluoro-1-prop-1-enoxy-4-[4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]benzene |
| SMILES | CC=COc1ccc(-c2ccc(OCC3CCC(C4CCC(CCC)CC4)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C31H40F2O2/c1-3-5-22-6-10-24(11-7-22)25-12-8-23(9-13-25)21-35-27-16-14-26(15-17-27)28-18-19-29(34-20-4-2)31(33)30(28)32/h4,14-20,22-25H,3,5-13,21H2,1-2H3 |
| InChIKey | VIGDZYFYWSMNFQ-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|