C24H34F2O2 — CID 90161576
1-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene (PubChem CID 90161576) has the molecular formula C24H34F2O2 and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene.
| Compound Name | 1-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90161576 |
| Molecular Formula | C24H34F2O2 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
| SMILES | C/C=C/Oc1ccc(OCC2CCC(C3CCC(CC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C24H34F2O2/c1-3-15-27-21-13-14-22(24(26)23(21)25)28-16-18-7-11-20(12-8-18)19-9-5-17(4-2)6-10-19/h3,13-15,17-20H,4-12,16H2,1-2H3/b15-3+ |
| InChIKey | NANMOYUYHOVQKH-CRKCGEKBSA-N |
| XLogP | 7.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|