C18H22F2O2 — CID 90161464
1-[(4-ethenylcyclohexyl)methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene (PubChem CID 90161464) has the molecular formula C18H22F2O2 and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-[(4-ethenylcyclohexyl)methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene.
| Compound Name | 1-[(4-ethenylcyclohexyl)methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90161464 |
| Molecular Formula | C18H22F2O2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-[(4-ethenylcyclohexyl)methoxy]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
| SMILES | C=CC1CCC(COc2ccc(O/C=C/C)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H22F2O2/c1-3-11-21-15-9-10-16(18(20)17(15)19)22-12-14-7-5-13(4-2)6-8-14/h3-4,9-11,13-14H,2,5-8,12H2,1H3/b11-3+ |
| InChIKey | ZAPNTLQLXBQECV-QDEBKDIKSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|