C22H30ClFO2 — CID 89305817
2-chloro-1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-3-fluoro-4-methoxybenzene (PubChem CID 89305817) has the molecular formula C22H30ClFO2 and a molecular weight of 380.93 g/mol. Its IUPAC name is 2-chloro-1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-3-fluoro-4-methoxybenzene.
| Compound Name | 2-chloro-1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-3-fluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 89305817 |
| Molecular Formula | C22H30ClFO2 |
| Molecular Weight | 380.93 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-chloro-1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-3-fluoro-4-methoxybenzene |
| SMILES | C=CC1CCC(C2CCC(COc3ccc(OC)c(F)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C22H30ClFO2/c1-3-15-4-8-17(9-5-15)18-10-6-16(7-11-18)14-26-19-12-13-20(25-2)22(24)21(19)23/h3,12-13,15-18H,1,4-11,14H2,2H3 |
| InChIKey | VDWWEDMITZRGMH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.93 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|