C30H44F2O2 — CID 139334314
1-ethoxy-2,3-difluoro-4-[[4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]methoxy]benzene (PubChem CID 139334314) has the molecular formula C30H44F2O2 and a molecular weight of 474.68 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[[4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]methoxy]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[[4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 139334314 |
| Molecular Formula | C30H44F2O2 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[[4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]methoxy]benzene |
| SMILES | CCOc1ccc(OCC2CCC(C3CCC(/C=C/C4CCC(C)CC4)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C30H44F2O2/c1-3-33-27-18-19-28(30(32)29(27)31)34-20-24-12-16-26(17-13-24)25-14-10-23(11-15-25)9-8-22-6-4-21(2)5-7-22/h8-9,18-19,21-26H,3-7,10-17,20H2,1-2H3/b9-8+ |
| InChIKey | FEWMBFKFCCNKNW-CMDGGOBGSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|