C19H26F2O3 — CID 67822338
1-ethoxy-2,3-difluoro-4-[[4-(3-methoxyprop-1-enyl)cyclohexyl]methoxy]benzene (PubChem CID 67822338) has the molecular formula C19H26F2O3 and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[[4-(3-methoxyprop-1-enyl)cyclohexyl]methoxy]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[[4-(3-methoxyprop-1-enyl)cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 67822338 |
| Molecular Formula | C19H26F2O3 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[[4-(3-methoxyprop-1-enyl)cyclohexyl]methoxy]benzene |
| SMILES | CCOc1ccc(OCC2CCC(C=CCOC)CC2)c(F)c1F |
| InChI | InChI=1S/C19H26F2O3/c1-3-23-16-10-11-17(19(21)18(16)20)24-13-15-8-6-14(7-9-15)5-4-12-22-2/h4-5,10-11,14-15H,3,6-9,12-13H2,1-2H3 |
| InChIKey | OHFIQZFMEBUMQE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|