C17H20F2O2 — CID 153282272
1-[(E)-3-cyclobutylprop-2-enoxy]-4-(cyclopropylmethoxy)-2,3-difluorobenzene (PubChem CID 153282272) has the molecular formula C17H20F2O2 and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[(E)-3-cyclobutylprop-2-enoxy]-4-(cyclopropylmethoxy)-2,3-difluorobenzene.
| Compound Name | 1-[(E)-3-cyclobutylprop-2-enoxy]-4-(cyclopropylmethoxy)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282272 |
| Molecular Formula | C17H20F2O2 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[(E)-3-cyclobutylprop-2-enoxy]-4-(cyclopropylmethoxy)-2,3-difluorobenzene |
| SMILES | Fc1c(OC/C=C/C2CCC2)ccc(OCC2CC2)c1F |
| InChI | InChI=1S/C17H20F2O2/c18-16-14(20-10-2-5-12-3-1-4-12)8-9-15(17(16)19)21-11-13-6-7-13/h2,5,8-9,12-13H,1,3-4,6-7,10-11H2/b5-2+ |
| InChIKey | WOTAXESWAIRXNV-GORDUTHDSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|