C14H16F2O2 — CID 153282322
1-(cyclobutylmethoxy)-4-cyclopropyloxy-2,3-difluorobenzene (PubChem CID 153282322) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-cyclopropyloxy-2,3-difluorobenzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-cyclopropyloxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282322 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-cyclopropyloxy-2,3-difluorobenzene |
| SMILES | Fc1c(OCC2CCC2)ccc(OC2CC2)c1F |
| InChI | InChI=1S/C14H16F2O2/c15-13-11(17-8-9-2-1-3-9)6-7-12(14(13)16)18-10-4-5-10/h6-7,9-10H,1-5,8H2 |
| InChIKey | ILOLQUSTGHHESA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |