C18H22F2O — CID 153282251
1-(cyclobutylmethoxy)-4-[(E)-4-cyclopropylbut-3-enyl]-2,3-difluorobenzene (PubChem CID 153282251) has the molecular formula C18H22F2O and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopropylbut-3-enyl]-2,3-difluorobenzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopropylbut-3-enyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282251 |
| Molecular Formula | C18H22F2O |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopropylbut-3-enyl]-2,3-difluorobenzene |
| SMILES | Fc1c(CC/C=C/C2CC2)ccc(OCC2CCC2)c1F |
| InChI | InChI=1S/C18H22F2O/c19-17-15(7-2-1-4-13-8-9-13)10-11-16(18(17)20)21-12-14-5-3-6-14/h1,4,10-11,13-14H,2-3,5-9,12H2/b4-1+ |
| InChIKey | BZQKYMOONYSCED-DAFODLJHSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|