C23H30F2O — CID 118886029
1-[(E)-but-2-enoxy]-2,3-difluoro-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]benzene (PubChem CID 118886029) has the molecular formula C23H30F2O and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]benzene.
| Compound Name | 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]benzene |
|---|---|
| PubChem CID | 118886029 |
| Molecular Formula | C23H30F2O |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-3-enyl]benzene |
| SMILES | C/C=C/COc1ccc(CC/C=C/C2CCC(/C=C/C)CC2)c(F)c1F |
| InChI | InChI=1S/C23H30F2O/c1-3-5-17-26-21-16-15-20(22(24)23(21)25)10-7-6-9-19-13-11-18(8-4-2)12-14-19/h3-6,8-9,15-16,18-19H,7,10-14,17H2,1-2H3/b5-3+,8-4+,9-6+ |
| InChIKey | JVQPMIOASMZCMH-UVMBBVGVSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|