C26H32F2O2 — CID 118888339
1-ethoxy-2,3-difluoro-4-[[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]phenoxy]methyl]benzene (PubChem CID 118888339) has the molecular formula C26H32F2O2 and a molecular weight of 414.54 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]phenoxy]methyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 118888339 |
| Molecular Formula | C26H32F2O2 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]phenoxy]methyl]benzene |
| SMILES | CCOc1ccc(COc2ccc(CC/C=C/C3CCC(C)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H32F2O2/c1-3-29-24-17-14-22(25(27)26(24)28)18-30-23-15-12-21(13-16-23)7-5-4-6-20-10-8-19(2)9-11-20/h4,6,12-17,19-20H,3,5,7-11,18H2,1-2H3/b6-4+ |
| InChIKey | UQVXRYWRPFQBSD-GQCTYLIASA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|