C24H26F4O — CID 163654172
1-[(E)-4-[4-(2,3-difluorophenyl)cyclohexyl]but-3-enyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 163654172) has the molecular formula C24H26F4O and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[(E)-4-[4-(2,3-difluorophenyl)cyclohexyl]but-3-enyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[(E)-4-[4-(2,3-difluorophenyl)cyclohexyl]but-3-enyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 163654172 |
| Molecular Formula | C24H26F4O |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[(E)-4-[4-(2,3-difluorophenyl)cyclohexyl]but-3-enyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCOc1ccc(CC/C=C/C2CCC(c3cccc(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C24H26F4O/c1-2-29-21-15-14-18(22(26)24(21)28)7-4-3-6-16-10-12-17(13-11-16)19-8-5-9-20(25)23(19)27/h3,5-6,8-9,14-17H,2,4,7,10-13H2,1H3/b6-3+ |
| InChIKey | IOTCUWSJQLIBLW-ZZXKWVIFSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|