C23H25F3O — CID 139860747
7-[(E)-but-2-enoxy]-1,2,8-trifluoro-3-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene (PubChem CID 139860747) has the molecular formula C23H25F3O and a molecular weight of 374.45 g/mol. Its IUPAC name is 7-[(E)-but-2-enoxy]-1,2,8-trifluoro-3-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene.
| Compound Name | 7-[(E)-but-2-enoxy]-1,2,8-trifluoro-3-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139860747 |
| Molecular Formula | C23H25F3O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 7-[(E)-but-2-enoxy]-1,2,8-trifluoro-3-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene |
| SMILES | C/C=C/COc1ccc2cc(C3CCC(/C=C/C)CC3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C23H25F3O/c1-3-5-13-27-19-12-11-17-14-18(21(24)23(26)20(17)22(19)25)16-9-7-15(6-4-2)8-10-16/h3-6,11-12,14-16H,7-10,13H2,1-2H3/b5-3+,6-4+ |
| InChIKey | KKOWDMHKKPVXQY-GGWOSOGESA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|