C23H30F4O — CID 175685885
1-(2,2-difluoroethoxy)-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 175685885) has the molecular formula C23H30F4O and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-(2,2-difluoroethoxy)-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 175685885 |
| Molecular Formula | C23H30F4O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | C/C=C/C1CCC(C2CCC(c3ccc(OCC(F)F)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C23H30F4O/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-20(23(27)22(19)26)28-14-21(24)25/h2-3,12-13,15-18,21H,4-11,14H2,1H3/b3-2+ |
| InChIKey | SJJMRDZIYLDTCS-NSCUHMNNSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|