C49H68F6O2 — CID 122542505
1-[9-(2,2-difluoroethenyl)-17-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]heptadecoxy]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]benzene (PubChem CID 122542505) has the molecular formula C49H68F6O2 and a molecular weight of 803.07 g/mol. Its IUPAC name is 1-[9-(2,2-difluoroethenyl)-17-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]heptadecoxy]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]benzene.
| Compound Name | 1-[9-(2,2-difluoroethenyl)-17-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]heptadecoxy]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 122542505 |
| Molecular Formula | C49H68F6O2 |
| Molecular Weight | 803.07 g/mol |
| Exact Mass | 802.51 |
| IUPAC Name | 1-[9-(2,2-difluoroethenyl)-17-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]heptadecoxy]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]benzene |
| SMILES | C/C=C/C1CCC(c2ccc(OCCCCCCCCC(C=C(F)F)CCCCCCCCOc3ccc(C4CCC(/C=C/C)CC4)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C49H68F6O2/c1-3-17-36-21-25-39(26-22-36)41-29-31-43(48(54)46(41)52)56-33-15-11-7-5-9-13-19-38(35-45(50)51)20-14-10-6-8-12-16-34-57-44-32-30-42(47(53)49(44)55)40-27-23-37(18-4-2)24-28-40/h3-4,17-18,29-32,35-40H,5-16,19-28,33-34H2,1-2H3/b17-3+,18-4+ |
| InChIKey | MREJXWDSYLKXKG-SCGPFSFSSA-N |
| XLogP | 16.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.07 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|