C43H49F9O3 — CID 122542592
1-(3,4-difluorophenyl)-4-[13-[[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]methoxy]-8-(1,2,2-trifluoroethenyl)tridecoxy]-2,3-difluorobenzene (PubChem CID 122542592) has the molecular formula C43H49F9O3 and a molecular weight of 784.84 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-[13-[[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]methoxy]-8-(1,2,2-trifluoroethenyl)tridecoxy]-2,3-difluorobenzene.
| Compound Name | 1-(3,4-difluorophenyl)-4-[13-[[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]methoxy]-8-(1,2,2-trifluoroethenyl)tridecoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 122542592 |
| Molecular Formula | C43H49F9O3 |
| Molecular Weight | 784.84 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-[13-[[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenoxy]methoxy]-8-(1,2,2-trifluoroethenyl)tridecoxy]-2,3-difluorobenzene |
| SMILES | C/C=C/C1CCC(c2ccc(OCOCCCCCC(CCCCCCCOc3ccc(-c4ccc(F)c(F)c4)c(F)c3F)C(F)=C(F)F)c(F)c2F)CC1 |
| InChI | InChI=1S/C43H49F9O3/c1-2-11-28-14-16-29(17-15-28)32-19-23-37(42(50)39(32)47)55-27-53-24-9-6-8-13-30(38(46)43(51)52)12-7-4-3-5-10-25-54-36-22-20-33(40(48)41(36)49)31-18-21-34(44)35(45)26-31/h2,11,18-23,26,28-30H,3-10,12-17,24-25,27H2,1H3/b11-2+ |
| InChIKey | SFNAUGNZNFABEY-BIIKFXOESA-N |
| XLogP | 14.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.84 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|