C24H27F3O — CID 20621656
1-[4-[4-[(E)-but-1-enyl]cyclohexyl]-3-fluorophenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 20621656) has the molecular formula C24H27F3O and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[4-[4-[(E)-but-1-enyl]cyclohexyl]-3-fluorophenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[4-[(E)-but-1-enyl]cyclohexyl]-3-fluorophenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 20621656 |
| Molecular Formula | C24H27F3O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-[4-[(E)-but-1-enyl]cyclohexyl]-3-fluorophenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CC/C=C/C1CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2F)CC1 |
| InChI | InChI=1S/C24H27F3O/c1-3-5-6-16-7-9-17(10-8-16)19-12-11-18(15-21(19)25)20-13-14-22(28-4-2)24(27)23(20)26/h5-6,11-17H,3-4,7-10H2,1-2H3/b6-5+ |
| InChIKey | RFDQSVYEZHAQMB-AATRIKPKSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|