C32H41F5O — CID 118316648
1-[2,3-difluoro-4-[4-[(Z)-12-fluorododec-1-enyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 118316648) has the molecular formula C32H41F5O and a molecular weight of 536.67 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[4-[(Z)-12-fluorododec-1-enyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[2,3-difluoro-4-[4-[(Z)-12-fluorododec-1-enyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 118316648 |
| Molecular Formula | C32H41F5O |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 1-[2,3-difluoro-4-[4-[(Z)-12-fluorododec-1-enyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(/C=C\CCCCCCCCCCF)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H41F5O/c1-2-38-28-21-20-27(31(36)32(28)37)26-19-18-25(29(34)30(26)35)24-16-14-23(15-17-24)13-11-9-7-5-3-4-6-8-10-12-22-33/h11,13,18-21,23-24H,2-10,12,14-17,22H2,1H3/b13-11- |
| InChIKey | LDZRTKBWMVKEDX-QBFSEMIESA-N |
| XLogP | 10.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|