C22H21F5O2 — CID 118316643
5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[(E)-3-fluoroprop-1-enyl]oxane (PubChem CID 118316643) has the molecular formula C22H21F5O2 and a molecular weight of 412.40 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[(E)-3-fluoroprop-1-enyl]oxane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[(E)-3-fluoroprop-1-enyl]oxane |
|---|---|
| PubChem CID | 118316643 |
| Molecular Formula | C22H21F5O2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[(E)-3-fluoroprop-1-enyl]oxane |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(/C=C/CF)OC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H21F5O2/c1-2-28-18-10-9-17(21(26)22(18)27)16-8-7-15(19(24)20(16)25)13-5-6-14(29-12-13)4-3-11-23/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3/b4-3+ |
| InChIKey | SQDUEIIXAVTGHL-ONEGZZNKSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|