C30H35F5O — CID 123727793
1-[2,3-difluoro-4-[4-[4-(4-fluorobut-1-enyl)cyclohexyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 123727793) has the molecular formula C30H35F5O and a molecular weight of 506.60 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[4-[4-(4-fluorobut-1-enyl)cyclohexyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[2,3-difluoro-4-[4-[4-(4-fluorobut-1-enyl)cyclohexyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 123727793 |
| Molecular Formula | C30H35F5O |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 1-[2,3-difluoro-4-[4-[4-(4-fluorobut-1-enyl)cyclohexyl]cyclohexyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(C4CCC(C=CCCF)CC4)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H35F5O/c1-2-36-26-17-16-25(29(34)30(26)35)24-15-14-23(27(32)28(24)33)22-12-10-21(11-13-22)20-8-6-19(7-9-20)5-3-4-18-31/h3,5,14-17,19-22H,2,4,6-13,18H2,1H3 |
| InChIKey | QAOODVVVCKOQLP-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|