C34H38F4O2 — CID 67734069
5-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]oxane (PubChem CID 67734069) has the molecular formula C34H38F4O2 and a molecular weight of 554.67 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]oxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 67734069 |
| Molecular Formula | C34H38F4O2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C34H38F4O2/c1-3-5-6-7-8-9-21-39-30-20-19-28(33(37)34(30)38)24-13-11-23(12-14-24)27-17-18-29(32(36)31(27)35)25-15-16-26(10-4-2)40-22-25/h4,10-14,17-20,25-26H,3,5-9,15-16,21-22H2,1-2H3/b10-4+ |
| InChIKey | ZYWKEZJFKAABMH-ONNFQVAWSA-N |
| XLogP | 10.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|