C32H34F4O3 — CID 77345297
5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane (PubChem CID 77345297) has the molecular formula C32H34F4O3 and a molecular weight of 542.61 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 77345297 |
| Molecular Formula | C32H34F4O3 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-pentoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane |
| SMILES | CC=CCCC1OCC(c2ccc(-c3ccc(-c4ccc(OCCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C32H34F4O3/c1-3-5-7-9-28-38-19-23(20-39-28)26-15-14-24(29(33)30(26)34)21-10-12-22(13-11-21)25-16-17-27(32(36)31(25)35)37-18-8-6-4-2/h3,5,10-17,23,28H,4,6-9,18-20H2,1-2H3 |
| InChIKey | RINWVRMZKRXLNI-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|