C33H36F4O2 — CID 77345292
5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane (PubChem CID 77345292) has the molecular formula C33H36F4O2 and a molecular weight of 540.64 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 77345292 |
| Molecular Formula | C33H36F4O2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluorophenyl]-2-pent-3-enyl-1,3-dioxane |
| SMILES | CC=CCCC1OCC(c2ccc(-c3ccc(-c4ccc(CCCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C33H36F4O2/c1-3-5-7-9-10-24-16-17-26(31(35)30(24)34)22-12-14-23(15-13-22)27-18-19-28(33(37)32(27)36)25-20-38-29(39-21-25)11-8-6-4-2/h4,6,12-19,25,29H,3,5,7-11,20-21H2,1-2H3 |
| InChIKey | YVLRULDLVOGWCL-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|