C32H34F4O2 — CID 67737162
5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 67737162) has the molecular formula C32H34F4O2 and a molecular weight of 526.61 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67737162 |
| Molecular Formula | C32H34F4O2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1OCC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C32H34F4O2/c1-3-5-7-9-23-15-16-25(30(34)29(23)33)21-11-13-22(14-12-21)26-17-18-27(32(36)31(26)35)24-19-37-28(38-20-24)10-8-6-4-2/h4,6,11-18,24,28H,3,5,7-10,19-20H2,1-2H3/b6-4+ |
| InChIKey | OMKVTEKOPUDZSO-GQCTYLIASA-N |
| XLogP | 9.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|