C30H30F4O3 — CID 67737207
2-but-3-enyl-5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane (PubChem CID 67737207) has the molecular formula C30H30F4O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is 2-but-3-enyl-5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane.
| Compound Name | 2-but-3-enyl-5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67737207 |
| Molecular Formula | C30H30F4O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-but-3-enyl-5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
| SMILES | C=CCCC1OCC(c2ccc(-c3ccc(-c4ccc(OCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C30H30F4O3/c1-3-5-7-26-36-17-21(18-37-26)24-13-12-22(27(31)28(24)32)19-8-10-20(11-9-19)23-14-15-25(30(34)29(23)33)35-16-6-4-2/h3,8-15,21,26H,1,4-7,16-18H2,2H3 |
| InChIKey | ZAJGJOOVHAOZCD-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|