C37H42F4O — CID 67738483
1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2,3-difluorobenzene (PubChem CID 67738483) has the molecular formula C37H42F4O and a molecular weight of 578.73 g/mol. Its IUPAC name is 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2,3-difluorobenzene.
| Compound Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67738483 |
| Molecular Formula | C37H42F4O |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2,3-difluorobenzene |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C37H42F4O/c1-3-5-6-24-7-9-25(10-8-24)26-11-13-27(14-12-26)30-19-20-31(35(39)34(30)38)28-15-17-29(18-16-28)32-21-22-33(42-23-4-2)37(41)36(32)40/h3,15-22,24-27H,1,4-14,23H2,2H3 |
| InChIKey | RNGVODMFHYUGDD-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|