C35H39F3O — CID 67737891
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene (PubChem CID 67737891) has the molecular formula C35H39F3O and a molecular weight of 532.69 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 67737891 |
| Molecular Formula | C35H39F3O |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCC)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C35H39F3O/c1-3-21-39-33-20-19-31(34(37)35(33)38)28-15-11-26(12-16-28)29-17-18-30(32(36)22-29)27-13-9-25(10-14-27)24-7-5-23(4-2)6-8-24/h4,11-12,15-20,22-25,27H,2-3,5-10,13-14,21H2,1H3 |
| InChIKey | LWKTVMFNOGCSSW-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|