C17H22F2O — CID 20621743
1-(4-ethenylcyclohexyl)-2,3-difluoro-4-propoxybenzene (PubChem CID 20621743) has the molecular formula C17H22F2O and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 20621743 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-propoxybenzene |
| SMILES | C=CC1CCC(c2ccc(OCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H22F2O/c1-3-11-20-15-10-9-14(16(18)17(15)19)13-7-5-12(4-2)6-8-13/h4,9-10,12-13H,2-3,5-8,11H2,1H3 |
| InChIKey | XQFXERFIVSSRRI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|