C15H20F2O — CID 90131075
1-cyclohexyl-2,3-difluoro-4-propoxybenzene (PubChem CID 90131075) has the molecular formula C15H20F2O and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-cyclohexyl-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 90131075 |
| Molecular Formula | C15H20F2O |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-cyclohexyl-2,3-difluoro-4-propoxybenzene |
| SMILES | CCCOc1ccc(C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C15H20F2O/c1-2-10-18-13-9-8-12(14(16)15(13)17)11-6-4-3-5-7-11/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | RSZACLBNWSRPDF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |