C32H42F2O — CID 154607073
2,3-difluoro-1-propoxy-4-[4-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]benzene (PubChem CID 154607073) has the molecular formula C32H42F2O and a molecular weight of 480.68 g/mol. Its IUPAC name is 2,3-difluoro-1-propoxy-4-[4-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]benzene.
| Compound Name | 2,3-difluoro-1-propoxy-4-[4-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 154607073 |
| Molecular Formula | C32H42F2O |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 2,3-difluoro-1-propoxy-4-[4-[(E)-2-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]benzene |
| SMILES | CCCOc1ccc(C2CCC(/C=C/C3CCC(c4ccc(CCC)cc4)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C32H42F2O/c1-3-5-23-8-14-26(15-9-23)27-16-10-24(11-17-27)6-7-25-12-18-28(19-13-25)29-20-21-30(35-22-4-2)32(34)31(29)33/h6-9,14-15,20-21,24-25,27-28H,3-5,10-13,16-19,22H2,1-2H3/b7-6+ |
| InChIKey | QILXRFAAZMRIKP-VOTSOKGWSA-N |
| XLogP | 9.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|